C33H24F26O3 — CID 10197435
2-(3-phenylmethoxyphenyl)-5,5-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,3-dioxane (PubChem CID 10197435) has the molecular formula C33H24F26O3 and a molecular weight of 962.50 g/mol. Its IUPAC name is 2-(3-phenylmethoxyphenyl)-5,5-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,3-dioxane.
| Compound Name | 2-(3-phenylmethoxyphenyl)-5,5-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,3-dioxane |
|---|---|
| PubChem CID | 10197435 |
| Molecular Formula | C33H24F26O3 |
| Molecular Weight | 962.50 g/mol |
| Exact Mass | 962.13 |
| IUPAC Name | 2-(3-phenylmethoxyphenyl)-5,5-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,3-dioxane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCC1(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)COC(c2cccc(OCc3ccccc3)c2)OC1 |
| InChI | InChI=1S/C33H24F26O3/c34-22(35,24(38,39)26(42,43)28(46,47)30(50,51)32(54,55)56)11-9-21(10-12-23(36,37)25(40,41)27(44,45)29(48,49)31(52,53)33(57,58)59)15-61-20(62-16-21)18-7-4-8-19(13-18)60-14-17-5-2-1-3-6-17/h1-8,13,20H,9-12,14-16H2 |
| InChIKey | SOHSSQCMCFDWEM-UHFFFAOYSA-N |
| XLogP | 13.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 962.50 |
| LogP ≤ 5 | 13.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|