C54H54N2O6 — CID 25108415
[3,9-dibenzyl-5,7,11-tris(hydroxymethyl)-6,12-bis(3-phenylmethoxyphenyl)-3,9-diazapentacyclo[6.4.0.02,7.04,11.05,10]dodecan-1-yl]methanol (PubChem CID 25108415) has the molecular formula C54H54N2O6 and a molecular weight of 827.03 g/mol. Its IUPAC name is [3,9-dibenzyl-5,7,11-tris(hydroxymethyl)-6,12-bis(3-phenylmethoxyphenyl)-3,9-diazapentacyclo[6.4.0.02,7.04,11.05,10]dodecan-1-yl]methanol.
| Compound Name | [3,9-dibenzyl-5,7,11-tris(hydroxymethyl)-6,12-bis(3-phenylmethoxyphenyl)-3,9-diazapentacyclo[6.4.0.02,7.04,11.05,10]dodecan-1-yl]methanol |
|---|---|
| PubChem CID | 25108415 |
| Molecular Formula | C54H54N2O6 |
| Molecular Weight | 827.03 g/mol |
| Exact Mass | 826.40 |
| IUPAC Name | [3,9-dibenzyl-5,7,11-tris(hydroxymethyl)-6,12-bis(3-phenylmethoxyphenyl)-3,9-diazapentacyclo[6.4.0.02,7.04,11.05,10]dodecan-1-yl]methanol |
| SMILES | OCC12C(c3cccc(OCc4ccccc4)c3)C3(CO)C4N(Cc5ccccc5)C1C1(CO)C(c5cccc(OCc6ccccc6)c5)C4(CO)C3N(Cc3ccccc3)C21 |
| InChI | InChI=1S/C54H54N2O6/c57-33-51-45(41-23-13-25-43(27-41)61-31-39-19-9-3-10-20-39)52(34-58)48-54(36-60)46(42-24-14-26-44(28-42)62-32-40-21-11-4-12-22-40)53(35-59,47(51)55(48)29-37-15-5-1-6-16-37)49(51)56(50(52)54)30-38-17-7-2-8-18-38/h1-28,45-50,57-60H,29-36H2 |
| InChIKey | PQLSPHGAUADNMW-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 105.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.03 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |