C13H16O4 — CID 139734184
(3R,4S,5R)-2-(2-phenylethenyl)oxane-3,4,5-triol (PubChem CID 139734184) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is (3R,4S,5R)-2-(2-phenylethenyl)oxane-3,4,5-triol.
| Compound Name | (3R,4S,5R)-2-(2-phenylethenyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 139734184 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (3R,4S,5R)-2-(2-phenylethenyl)oxane-3,4,5-triol |
| SMILES | O[C@H]1[C@H](O)COC(C=Cc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C13H16O4/c14-10-8-17-11(13(16)12(10)15)7-6-9-4-2-1-3-5-9/h1-7,10-16H,8H2/t10-,11?,12+,13+/m1/s1 |
| InChIKey | AJUDVOGGZVUARC-DMPSADRZSA-N |
| XLogP | 0.18 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |