C13H16O4 — CID 102309158
(3S,4R)-2-[(E)-2-(4-methoxyphenyl)ethenyl]oxolane-3,4-diol (PubChem CID 102309158) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is (3S,4R)-2-[(E)-2-(4-methoxyphenyl)ethenyl]oxolane-3,4-diol.
| Compound Name | (3S,4R)-2-[(E)-2-(4-methoxyphenyl)ethenyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 102309158 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (3S,4R)-2-[(E)-2-(4-methoxyphenyl)ethenyl]oxolane-3,4-diol |
| SMILES | COc1ccc(/C=C/C2OC[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C13H16O4/c1-16-10-5-2-9(3-6-10)4-7-12-13(15)11(14)8-17-12/h2-7,11-15H,8H2,1H3/b7-4+/t11-,12?,13+/m1/s1 |
| InChIKey | RIRDAUQAFKBBSN-WLPFRBADSA-N |
| XLogP | 0.83 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |