C15H20O3 — CID 102385055
(2S,3S)-2-methoxy-3-[(E)-2-(4-methoxyphenyl)ethenyl]oxane (PubChem CID 102385055) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (2S,3S)-2-methoxy-3-[(E)-2-(4-methoxyphenyl)ethenyl]oxane.
| Compound Name | (2S,3S)-2-methoxy-3-[(E)-2-(4-methoxyphenyl)ethenyl]oxane |
|---|---|
| PubChem CID | 102385055 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (2S,3S)-2-methoxy-3-[(E)-2-(4-methoxyphenyl)ethenyl]oxane |
| SMILES | COc1ccc(/C=C/[C@@H]2CCCO[C@@H]2OC)cc1 |
| InChI | InChI=1S/C15H20O3/c1-16-14-9-6-12(7-10-14)5-8-13-4-3-11-18-15(13)17-2/h5-10,13,15H,3-4,11H2,1-2H3/b8-5+/t13-,15-/m0/s1 |
| InChIKey | NTVRBHZLQGDFFA-MNOINKQASA-N |
| XLogP | 3.11 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |