C18H20O6 — CID 13494254
2,3-bis(4-methoxyphenoxy)-1,4-dioxane (PubChem CID 13494254) has the molecular formula C18H20O6 and a molecular weight of 332.35 g/mol. Its IUPAC name is 2,3-bis(4-methoxyphenoxy)-1,4-dioxane.
| Compound Name | 2,3-bis(4-methoxyphenoxy)-1,4-dioxane |
|---|---|
| PubChem CID | 13494254 |
| Molecular Formula | C18H20O6 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 2,3-bis(4-methoxyphenoxy)-1,4-dioxane |
| SMILES | COc1ccc(OC2OCCOC2Oc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C18H20O6/c1-19-13-3-7-15(8-4-13)23-17-18(22-12-11-21-17)24-16-9-5-14(20-2)6-10-16/h3-10,17-18H,11-12H2,1-2H3 |
| InChIKey | JWEQDIDETNRDIL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |