C16H14F2O4 — CID 3320956
2,3-bis(4-fluorophenoxy)-1,4-dioxane (PubChem CID 3320956) has the molecular formula C16H14F2O4 and a molecular weight of 308.28 g/mol. Its IUPAC name is 2,3-bis(4-fluorophenoxy)-1,4-dioxane.
| Compound Name | 2,3-bis(4-fluorophenoxy)-1,4-dioxane |
|---|---|
| PubChem CID | 3320956 |
| Molecular Formula | C16H14F2O4 |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2,3-bis(4-fluorophenoxy)-1,4-dioxane |
| SMILES | Fc1ccc(OC2OCCOC2Oc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C16H14F2O4/c17-11-1-5-13(6-2-11)21-15-16(20-10-9-19-15)22-14-7-3-12(18)4-8-14/h1-8,15-16H,9-10H2 |
| InChIKey | LWLFNVVVVQUANV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |