About (4-fluorophenyl) hypobromite
(4-fluorophenyl) hypobromite (PubChem CID 19745276) has the molecular formula C6H4BrFO
and a molecular weight of 191.00 g/mol. Its IUPAC name is (4-fluorophenyl) hypobromite.
Molecular Properties
| Compound Name | (4-fluorophenyl) hypobromite |
| PubChem CID | 19745276 |
| Molecular Formula | C6H4BrFO |
| Molecular Weight | 191.00 g/mol |
| Exact Mass | 189.94 |
| IUPAC Name | (4-fluorophenyl) hypobromite |
| SMILES | Fc1ccc(OBr)cc1 |
| InChI | InChI=1S/C6H4BrFO/c7-9-6-3-1-5(8)2-4-6/h1-4H |
| InChIKey | UZDDTBCGZZHURW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.00 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4-fluorophenyl) hypobromite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluorophenyl) hypobromite?
The IUPAC name of (4-fluorophenyl) hypobromite (CID 19745276) is (4-fluorophenyl) hypobromite.
What is the SMILES notation for (4-fluorophenyl) hypobromite?
The canonical SMILES for (4-fluorophenyl) hypobromite is Fc1ccc(OBr)cc1.
What is the InChIKey of (4-fluorophenyl) hypobromite?
The InChIKey is UZDDTBCGZZHURW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrFO/c7-9-6-3-1-5(8)2-4-6/h1-4H.
What are the key properties of (4-fluorophenyl) hypobromite?
(4-fluorophenyl) hypobromite has a molecular weight of 191.00 g/mol, XLogP of 2.51, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl) hypobromite is sourced from PubChem (CID 19745276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).