C28H24O4 — CID 2311165
(2R,3R)-2,3-bis(2-phenylphenoxy)-1,4-dioxane (PubChem CID 2311165) has the molecular formula C28H24O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is (2R,3R)-2,3-bis(2-phenylphenoxy)-1,4-dioxane.
| Compound Name | (2R,3R)-2,3-bis(2-phenylphenoxy)-1,4-dioxane |
|---|---|
| PubChem CID | 2311165 |
| Molecular Formula | C28H24O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | (2R,3R)-2,3-bis(2-phenylphenoxy)-1,4-dioxane |
| SMILES | c1ccc(-c2ccccc2O[C@H]2OCCO[C@@H]2Oc2ccccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H24O4/c1-3-11-21(12-4-1)23-15-7-9-17-25(23)31-27-28(30-20-19-29-27)32-26-18-10-8-16-24(26)22-13-5-2-6-14-22/h1-18,27-28H,19-20H2/t27-,28-/m1/s1 |
| InChIKey | YAXDSMYNNBMXKF-VSGBNLITSA-N |
| XLogP | 6.18 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |