C26H32O8 — CID 25358013
butyl 4-[[(2S,3S)-3-(4-butoxycarbonylphenoxy)-1,4-dioxan-2-yl]oxy]benzoate (PubChem CID 25358013) has the molecular formula C26H32O8 and a molecular weight of 472.53 g/mol. Its IUPAC name is butyl 4-[[(2S,3S)-3-(4-butoxycarbonylphenoxy)-1,4-dioxan-2-yl]oxy]benzoate.
| Compound Name | butyl 4-[[(2S,3S)-3-(4-butoxycarbonylphenoxy)-1,4-dioxan-2-yl]oxy]benzoate |
|---|---|
| PubChem CID | 25358013 |
| Molecular Formula | C26H32O8 |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | butyl 4-[[(2S,3S)-3-(4-butoxycarbonylphenoxy)-1,4-dioxan-2-yl]oxy]benzoate |
| SMILES | CCCCOC(=O)c1ccc(O[C@@H]2OCCO[C@H]2Oc2ccc(C(=O)OCCCC)cc2)cc1 |
| InChI | InChI=1S/C26H32O8/c1-3-5-15-29-23(27)19-7-11-21(12-8-19)33-25-26(32-18-17-31-25)34-22-13-9-20(10-14-22)24(28)30-16-6-4-2/h7-14,25-26H,3-6,15-18H2,1-2H3/t25-,26-/m0/s1 |
| InChIKey | QJXSCHMYAZCEOD-UIOOFZCWSA-N |
| XLogP | 4.76 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|