C12H14O4 — CID 66570582
2-(1,3-dioxolan-2-yl)-1-(4-methoxyphenyl)ethanone (PubChem CID 66570582) has the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is 2-(1,3-dioxolan-2-yl)-1-(4-methoxyphenyl)ethanone.
| Compound Name | 2-(1,3-dioxolan-2-yl)-1-(4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 66570582 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 2-(1,3-dioxolan-2-yl)-1-(4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)CC2OCCO2)cc1 |
| InChI | InChI=1S/C12H14O4/c1-14-10-4-2-9(3-5-10)11(13)8-12-15-6-7-16-12/h2-5,12H,6-8H2,1H3 |
| InChIKey | JHGMJQJHLOMJGE-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |