C12H14O3 — CID 66570584
2-(1,3-dioxolan-2-yl)-1-(3-methylphenyl)ethanone (PubChem CID 66570584) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is 2-(1,3-dioxolan-2-yl)-1-(3-methylphenyl)ethanone.
| Compound Name | 2-(1,3-dioxolan-2-yl)-1-(3-methylphenyl)ethanone |
|---|---|
| PubChem CID | 66570584 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 2-(1,3-dioxolan-2-yl)-1-(3-methylphenyl)ethanone |
| SMILES | Cc1cccc(C(=O)CC2OCCO2)c1 |
| InChI | InChI=1S/C12H14O3/c1-9-3-2-4-10(7-9)11(13)8-12-14-5-6-15-12/h2-4,7,12H,5-6,8H2,1H3 |
| InChIKey | MFHVHANONQNXFY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |