C23H24O2 — CID 122385088
2-[(1S)-2-(3-methylbenzoyl)cyclohex-2-en-1-yl]-1-(3-methylphenyl)ethanone (PubChem CID 122385088) has the molecular formula C23H24O2 and a molecular weight of 332.44 g/mol. Its IUPAC name is 2-[(1S)-2-(3-methylbenzoyl)cyclohex-2-en-1-yl]-1-(3-methylphenyl)ethanone.
| Compound Name | 2-[(1S)-2-(3-methylbenzoyl)cyclohex-2-en-1-yl]-1-(3-methylphenyl)ethanone |
|---|---|
| PubChem CID | 122385088 |
| Molecular Formula | C23H24O2 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 2-[(1S)-2-(3-methylbenzoyl)cyclohex-2-en-1-yl]-1-(3-methylphenyl)ethanone |
| SMILES | Cc1cccc(C(=O)C[C@@H]2CCCC=C2C(=O)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C23H24O2/c1-16-7-5-10-19(13-16)22(24)15-18-9-3-4-12-21(18)23(25)20-11-6-8-17(2)14-20/h5-8,10-14,18H,3-4,9,15H2,1-2H3/t18-/m0/s1 |
| InChIKey | KRCHKEFHOSWPNU-SFHVURJKSA-N |
| XLogP | 5.49 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |