C23H24O4 — CID 71486460
2-[(1R)-2-(3-methoxybenzoyl)cyclohex-2-en-1-yl]-1-(3-methoxyphenyl)ethanone (PubChem CID 71486460) has the molecular formula C23H24O4 and a molecular weight of 364.44 g/mol. Its IUPAC name is 2-[(1R)-2-(3-methoxybenzoyl)cyclohex-2-en-1-yl]-1-(3-methoxyphenyl)ethanone.
| Compound Name | 2-[(1R)-2-(3-methoxybenzoyl)cyclohex-2-en-1-yl]-1-(3-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 71486460 |
| Molecular Formula | C23H24O4 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 2-[(1R)-2-(3-methoxybenzoyl)cyclohex-2-en-1-yl]-1-(3-methoxyphenyl)ethanone |
| SMILES | COc1cccc(C(=O)C[C@H]2CCCC=C2C(=O)c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C23H24O4/c1-26-19-10-5-8-17(13-19)22(24)15-16-7-3-4-12-21(16)23(25)18-9-6-11-20(14-18)27-2/h5-6,8-14,16H,3-4,7,15H2,1-2H3/t16-/m1/s1 |
| InChIKey | IJOSNEODAZVEQW-MRXNPFEDSA-N |
| XLogP | 4.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |