C21H22O2 — CID 23642763
2-[(2E)-2-[(3-methoxyphenyl)methylidene]cyclopentyl]-1-phenylethanone (PubChem CID 23642763) has the molecular formula C21H22O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-[(2E)-2-[(3-methoxyphenyl)methylidene]cyclopentyl]-1-phenylethanone.
| Compound Name | 2-[(2E)-2-[(3-methoxyphenyl)methylidene]cyclopentyl]-1-phenylethanone |
|---|---|
| PubChem CID | 23642763 |
| Molecular Formula | C21H22O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 2-[(2E)-2-[(3-methoxyphenyl)methylidene]cyclopentyl]-1-phenylethanone |
| SMILES | COc1cccc(/C=C2\CCCC2CC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C21H22O2/c1-23-20-12-5-7-16(14-20)13-18-10-6-11-19(18)15-21(22)17-8-3-2-4-9-17/h2-5,7-9,12-14,19H,6,10-11,15H2,1H3/b18-13+ |
| InChIKey | WYIVPYMJTPFLQC-QGOAFFKASA-N |
| XLogP | 5.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |