C20H19NO3 — CID 24938484
2-[(2Z)-2-[(3-nitrophenyl)methylidene]cyclopentyl]-1-phenylethanone (PubChem CID 24938484) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is 2-[(2Z)-2-[(3-nitrophenyl)methylidene]cyclopentyl]-1-phenylethanone.
| Compound Name | 2-[(2Z)-2-[(3-nitrophenyl)methylidene]cyclopentyl]-1-phenylethanone |
|---|---|
| PubChem CID | 24938484 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 2-[(2Z)-2-[(3-nitrophenyl)methylidene]cyclopentyl]-1-phenylethanone |
| SMILES | O=C(CC1CCC/C1=C/c1cccc([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C20H19NO3/c22-20(16-7-2-1-3-8-16)14-18-10-5-9-17(18)12-15-6-4-11-19(13-15)21(23)24/h1-4,6-8,11-13,18H,5,9-10,14H2/b17-12- |
| InChIKey | LPCIABFRAZGYMK-ATVHPVEESA-N |
| XLogP | 5.05 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|