C17H18N2O4S — CID 171935687
1-(2-amino-2,4,5,6,7,7a-hexahydro-1-benzothiophen-3-yl)-3-(3-nitrophenyl)propane-1,3-dione (PubChem CID 171935687) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is 1-(2-amino-2,4,5,6,7,7a-hexahydro-1-benzothiophen-3-yl)-3-(3-nitrophenyl)propane-1,3-dione.
| Compound Name | 1-(2-amino-2,4,5,6,7,7a-hexahydro-1-benzothiophen-3-yl)-3-(3-nitrophenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 171935687 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 1-(2-amino-2,4,5,6,7,7a-hexahydro-1-benzothiophen-3-yl)-3-(3-nitrophenyl)propane-1,3-dione |
| SMILES | NC1SC2CCCCC2=C1C(=O)CC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H18N2O4S/c18-17-16(12-6-1-2-7-15(12)24-17)14(21)9-13(20)10-4-3-5-11(8-10)19(22)23/h3-5,8,15,17H,1-2,6-7,9,18H2 |
| InChIKey | YWYOSIXLEAWRJK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|