C12H11NO5 — CID 23742110
[2-(3-nitrophenyl)-2-oxoethyl] cyclopropanecarboxylate (PubChem CID 23742110) has the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. Its IUPAC name is [2-(3-nitrophenyl)-2-oxoethyl] cyclopropanecarboxylate.
| Compound Name | [2-(3-nitrophenyl)-2-oxoethyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 23742110 |
| Molecular Formula | C12H11NO5 |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | [2-(3-nitrophenyl)-2-oxoethyl] cyclopropanecarboxylate |
| SMILES | O=C(COC(=O)C1CC1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H11NO5/c14-11(7-18-12(15)8-4-5-8)9-2-1-3-10(6-9)13(16)17/h1-3,6,8H,4-5,7H2 |
| InChIKey | YLMGLJZGPGRSON-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|