C11H11BrO3 — CID 66570596
1-(4-bromophenyl)-2-(1,3-dioxolan-2-yl)ethanone (PubChem CID 66570596) has the molecular formula C11H11BrO3 and a molecular weight of 271.11 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-(1,3-dioxolan-2-yl)ethanone.
| Compound Name | 1-(4-bromophenyl)-2-(1,3-dioxolan-2-yl)ethanone |
|---|---|
| PubChem CID | 66570596 |
| Molecular Formula | C11H11BrO3 |
| Molecular Weight | 271.11 g/mol |
| Exact Mass | 269.99 |
| IUPAC Name | 1-(4-bromophenyl)-2-(1,3-dioxolan-2-yl)ethanone |
| SMILES | O=C(CC1OCCO1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H11BrO3/c12-9-3-1-8(2-4-9)10(13)7-11-14-5-6-15-11/h1-4,11H,5-7H2 |
| InChIKey | SEYZZJSEGGRCRG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.11 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |