C12H13BrO3 — CID 90923108
1-(4-bromophenyl)-3-(1,3-dioxolan-2-yl)propan-2-one (PubChem CID 90923108) has the molecular formula C12H13BrO3 and a molecular weight of 285.14 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-(1,3-dioxolan-2-yl)propan-2-one.
| Compound Name | 1-(4-bromophenyl)-3-(1,3-dioxolan-2-yl)propan-2-one |
|---|---|
| PubChem CID | 90923108 |
| Molecular Formula | C12H13BrO3 |
| Molecular Weight | 285.14 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | 1-(4-bromophenyl)-3-(1,3-dioxolan-2-yl)propan-2-one |
| SMILES | O=C(Cc1ccc(Br)cc1)CC1OCCO1 |
| InChI | InChI=1S/C12H13BrO3/c13-10-3-1-9(2-4-10)7-11(14)8-12-15-5-6-16-12/h1-4,12H,5-8H2 |
| InChIKey | NRXSZAKDBPOHEP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.14 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |