C11H13BrO2 — CID 67156103
2-[(4-bromophenyl)methyl]-1,3-dioxane (PubChem CID 67156103) has the molecular formula C11H13BrO2 and a molecular weight of 257.13 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl]-1,3-dioxane.
| Compound Name | 2-[(4-bromophenyl)methyl]-1,3-dioxane |
|---|---|
| PubChem CID | 67156103 |
| Molecular Formula | C11H13BrO2 |
| Molecular Weight | 257.13 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 2-[(4-bromophenyl)methyl]-1,3-dioxane |
| SMILES | Brc1ccc(CC2OCCCO2)cc1 |
| InChI | InChI=1S/C11H13BrO2/c12-10-4-2-9(3-5-10)8-11-13-6-1-7-14-11/h2-5,11H,1,6-8H2 |
| InChIKey | WLNRFMRVUTYXOY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.13 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |