C13H17BrO3 — CID 97293209
(1S)-1-(4-bromophenyl)-3-(1,3-dioxan-2-yl)propan-1-ol (PubChem CID 97293209) has the molecular formula C13H17BrO3 and a molecular weight of 301.18 g/mol. Its IUPAC name is (1S)-1-(4-bromophenyl)-3-(1,3-dioxan-2-yl)propan-1-ol.
| Compound Name | (1S)-1-(4-bromophenyl)-3-(1,3-dioxan-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 97293209 |
| Molecular Formula | C13H17BrO3 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | (1S)-1-(4-bromophenyl)-3-(1,3-dioxan-2-yl)propan-1-ol |
| SMILES | O[C@@H](CCC1OCCCO1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H17BrO3/c14-11-4-2-10(3-5-11)12(15)6-7-13-16-8-1-9-17-13/h2-5,12-13,15H,1,6-9H2/t12-/m0/s1 |
| InChIKey | XUQFXAHEXAVZAU-LBPRGKRZSA-N |
| XLogP | 3.03 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |