C13H16Cl2O3 — CID 97293217
(1S)-1-(2,3-dichlorophenyl)-3-(1,3-dioxan-2-yl)propan-1-ol (PubChem CID 97293217) has the molecular formula C13H16Cl2O3 and a molecular weight of 291.17 g/mol. Its IUPAC name is (1S)-1-(2,3-dichlorophenyl)-3-(1,3-dioxan-2-yl)propan-1-ol.
| Compound Name | (1S)-1-(2,3-dichlorophenyl)-3-(1,3-dioxan-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 97293217 |
| Molecular Formula | C13H16Cl2O3 |
| Molecular Weight | 291.17 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | (1S)-1-(2,3-dichlorophenyl)-3-(1,3-dioxan-2-yl)propan-1-ol |
| SMILES | O[C@@H](CCC1OCCCO1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H16Cl2O3/c14-10-4-1-3-9(13(10)15)11(16)5-6-12-17-7-2-8-18-12/h1,3-4,11-12,16H,2,5-8H2/t11-/m0/s1 |
| InChIKey | LWKUDSVWWLLABC-NSHDSACASA-N |
| XLogP | 3.57 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.17 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |