C13H17FO3 — CID 91658309
3-(1,3-dioxan-2-yl)-1-(3-fluorophenyl)propan-1-ol (PubChem CID 91658309) has the molecular formula C13H17FO3 and a molecular weight of 240.27 g/mol. Its IUPAC name is 3-(1,3-dioxan-2-yl)-1-(3-fluorophenyl)propan-1-ol.
| Compound Name | 3-(1,3-dioxan-2-yl)-1-(3-fluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 91658309 |
| Molecular Formula | C13H17FO3 |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 3-(1,3-dioxan-2-yl)-1-(3-fluorophenyl)propan-1-ol |
| SMILES | OC(CCC1OCCCO1)c1cccc(F)c1 |
| InChI | InChI=1S/C13H17FO3/c14-11-4-1-3-10(9-11)12(15)5-6-13-16-7-2-8-17-13/h1,3-4,9,12-13,15H,2,5-8H2 |
| InChIKey | BRRYIYPNYFDTCF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |