C21H26F2O2 — CID 161209370
(1S)-1-(3-fluorophenyl)-4,4-dimethylpentan-1-ol;(2R)-2-(3-fluorophenyl)oxirane (PubChem CID 161209370) has the molecular formula C21H26F2O2 and a molecular weight of 348.43 g/mol. Its IUPAC name is (1S)-1-(3-fluorophenyl)-4,4-dimethylpentan-1-ol;(2R)-2-(3-fluorophenyl)oxirane.
| Compound Name | (1S)-1-(3-fluorophenyl)-4,4-dimethylpentan-1-ol;(2R)-2-(3-fluorophenyl)oxirane |
|---|---|
| PubChem CID | 161209370 |
| Molecular Formula | C21H26F2O2 |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | (1S)-1-(3-fluorophenyl)-4,4-dimethylpentan-1-ol;(2R)-2-(3-fluorophenyl)oxirane |
| SMILES | CC(C)(C)CC[C@H](O)c1cccc(F)c1.Fc1cccc([C@@H]2CO2)c1 |
| InChI | InChI=1S/C13H19FO.C8H7FO/c1-13(2,3)8-7-12(15)10-5-4-6-11(14)9-10;9-7-3-1-2-6(4-7)8-5-10-8/h4-6,9,12,15H,7-8H2,1-3H3;1-4,8H,5H2/t12-;8-/m00/s1 |
| InChIKey | UWAKZTMGTRUOCV-KEUUFYAISA-N |
| XLogP | 5.58 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|