C14H22ClFO — CID 158976565
(1S)-1-(3-fluorophenyl)-5,5-dimethylhexan-1-ol;hydrochloride (PubChem CID 158976565) has the molecular formula C14H22ClFO and a molecular weight of 260.78 g/mol. Its IUPAC name is (1S)-1-(3-fluorophenyl)-5,5-dimethylhexan-1-ol;hydrochloride.
| Compound Name | (1S)-1-(3-fluorophenyl)-5,5-dimethylhexan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 158976565 |
| Molecular Formula | C14H22ClFO |
| Molecular Weight | 260.78 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (1S)-1-(3-fluorophenyl)-5,5-dimethylhexan-1-ol;hydrochloride |
| SMILES | CC(C)(C)CCC[C@H](O)c1cccc(F)c1.Cl |
| InChI | InChI=1S/C14H21FO.ClH/c1-14(2,3)9-5-8-13(16)11-6-4-7-12(15)10-11;/h4,6-7,10,13,16H,5,8-9H2,1-3H3;1H/t13-;/m0./s1 |
| InChIKey | OZXKRUNSGLDLEJ-ZOWNYOTGSA-N |
| XLogP | 4.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.78 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |