C14H20FNO4 — CID 155695819
tert-butyl N-[(3S)-3-(3-fluorophenyl)-3-hydroxypropoxy]carbamate (PubChem CID 155695819) has the molecular formula C14H20FNO4 and a molecular weight of 285.31 g/mol. Its IUPAC name is tert-butyl N-[(3S)-3-(3-fluorophenyl)-3-hydroxypropoxy]carbamate.
| Compound Name | tert-butyl N-[(3S)-3-(3-fluorophenyl)-3-hydroxypropoxy]carbamate |
|---|---|
| PubChem CID | 155695819 |
| Molecular Formula | C14H20FNO4 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | tert-butyl N-[(3S)-3-(3-fluorophenyl)-3-hydroxypropoxy]carbamate |
| SMILES | CC(C)(C)OC(=O)NOCC[C@H](O)c1cccc(F)c1 |
| InChI | InChI=1S/C14H20FNO4/c1-14(2,3)20-13(18)16-19-8-7-12(17)10-5-4-6-11(15)9-10/h4-6,9,12,17H,7-8H2,1-3H3,(H,16,18)/t12-/m0/s1 |
| InChIKey | ATLFZJNLTILICU-LBPRGKRZSA-N |
| XLogP | 2.71 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|