C14H20O4 — CID 97293200
(1R)-3-(1,3-dioxan-2-yl)-1-(2-methoxyphenyl)propan-1-ol (PubChem CID 97293200) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is (1R)-3-(1,3-dioxan-2-yl)-1-(2-methoxyphenyl)propan-1-ol.
| Compound Name | (1R)-3-(1,3-dioxan-2-yl)-1-(2-methoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 97293200 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (1R)-3-(1,3-dioxan-2-yl)-1-(2-methoxyphenyl)propan-1-ol |
| SMILES | COc1ccccc1[C@H](O)CCC1OCCCO1 |
| InChI | InChI=1S/C14H20O4/c1-16-13-6-3-2-5-11(13)12(15)7-8-14-17-9-4-10-18-14/h2-3,5-6,12,14-15H,4,7-10H2,1H3/t12-/m1/s1 |
| InChIKey | LESKOTFKQGXFJY-GFCCVEGCSA-N |
| XLogP | 2.27 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |