C13H18O5S — CID 66474370
2-[2-(2-methoxyphenyl)sulfonylethyl]-1,3-dioxane (PubChem CID 66474370) has the molecular formula C13H18O5S and a molecular weight of 286.35 g/mol. Its IUPAC name is 2-[2-(2-methoxyphenyl)sulfonylethyl]-1,3-dioxane.
| Compound Name | 2-[2-(2-methoxyphenyl)sulfonylethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 66474370 |
| Molecular Formula | C13H18O5S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 2-[2-(2-methoxyphenyl)sulfonylethyl]-1,3-dioxane |
| SMILES | COc1ccccc1S(=O)(=O)CCC1OCCCO1 |
| InChI | InChI=1S/C13H18O5S/c1-16-11-5-2-3-6-12(11)19(14,15)10-7-13-17-8-4-9-18-13/h2-3,5-6,13H,4,7-10H2,1H3 |
| InChIKey | URJRGORGTIEEKB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |