C20H21Cl4NO2 — CID 161287021
2-(cyclobutylamino)-1-(2,3-dichlorophenyl)ethanol;2-(2,3-dichlorophenyl)oxirane (PubChem CID 161287021) has the molecular formula C20H21Cl4NO2 and a molecular weight of 449.21 g/mol. Its IUPAC name is 2-(cyclobutylamino)-1-(2,3-dichlorophenyl)ethanol;2-(2,3-dichlorophenyl)oxirane.
| Compound Name | 2-(cyclobutylamino)-1-(2,3-dichlorophenyl)ethanol;2-(2,3-dichlorophenyl)oxirane |
|---|---|
| PubChem CID | 161287021 |
| Molecular Formula | C20H21Cl4NO2 |
| Molecular Weight | 449.21 g/mol |
| Exact Mass | 447.03 |
| IUPAC Name | 2-(cyclobutylamino)-1-(2,3-dichlorophenyl)ethanol;2-(2,3-dichlorophenyl)oxirane |
| SMILES | Clc1cccc(C2CO2)c1Cl.OC(CNC1CCC1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C12H15Cl2NO.C8H6Cl2O/c13-10-6-2-5-9(12(10)14)11(16)7-15-8-3-1-4-8;9-6-3-1-2-5(8(6)10)7-4-11-7/h2,5-6,8,11,15-16H,1,3-4,7H2;1-3,7H,4H2 |
| InChIKey | VFVVSSVDNNKUPT-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 44.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.21 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|