C14H20ClNO2 — CID 106360636
1-(2-chlorophenyl)-2-[[2-(hydroxymethyl)cyclopentyl]amino]ethanol (PubChem CID 106360636) has the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-2-[[2-(hydroxymethyl)cyclopentyl]amino]ethanol.
| Compound Name | 1-(2-chlorophenyl)-2-[[2-(hydroxymethyl)cyclopentyl]amino]ethanol |
|---|---|
| PubChem CID | 106360636 |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 1-(2-chlorophenyl)-2-[[2-(hydroxymethyl)cyclopentyl]amino]ethanol |
| SMILES | OCC1CCCC1NCC(O)c1ccccc1Cl |
| InChI | InChI=1S/C14H20ClNO2/c15-12-6-2-1-5-11(12)14(18)8-16-13-7-3-4-10(13)9-17/h1-2,5-6,10,13-14,16-18H,3-4,7-9H2 |
| InChIKey | TYFWTHGQJDGTGW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |