C7H14O4 — CID 144545120
3-(1,3-dioxan-2-yl)propane-1,1-diol (PubChem CID 144545120) has the molecular formula C7H14O4 and a molecular weight of 162.18 g/mol. Its IUPAC name is 3-(1,3-dioxan-2-yl)propane-1,1-diol.
| Compound Name | 3-(1,3-dioxan-2-yl)propane-1,1-diol |
|---|---|
| PubChem CID | 144545120 |
| Molecular Formula | C7H14O4 |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 3-(1,3-dioxan-2-yl)propane-1,1-diol |
| SMILES | OC(O)CCC1OCCCO1 |
| InChI | InChI=1S/C7H14O4/c8-6(9)2-3-7-10-4-1-5-11-7/h6-9H,1-5H2 |
| InChIKey | YVIXGKYLHUUWCJ-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|