C7H14O3 — CID 14290520
(2S)-1-(1,3-dioxan-2-yl)propan-2-ol (PubChem CID 14290520) has the molecular formula C7H14O3 and a molecular weight of 146.19 g/mol. Its IUPAC name is (2S)-1-(1,3-dioxan-2-yl)propan-2-ol.
| Compound Name | (2S)-1-(1,3-dioxan-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 14290520 |
| Molecular Formula | C7H14O3 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | (2S)-1-(1,3-dioxan-2-yl)propan-2-ol |
| SMILES | C[C@H](O)CC1OCCCO1 |
| InChI | InChI=1S/C7H14O3/c1-6(8)5-7-9-3-2-4-10-7/h6-8H,2-5H2,1H3/t6-/m0/s1 |
| InChIKey | ZMWQBLCFFNVLGR-LURJTMIESA-N |
| XLogP | 0.52 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |