C8H16O3 — CID 130148324
1-(1,3-dioxan-2-yl)butan-2-ol (PubChem CID 130148324) has the molecular formula C8H16O3 and a molecular weight of 160.21 g/mol. Its IUPAC name is 1-(1,3-dioxan-2-yl)butan-2-ol.
| Compound Name | 1-(1,3-dioxan-2-yl)butan-2-ol |
|---|---|
| PubChem CID | 130148324 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | 1-(1,3-dioxan-2-yl)butan-2-ol |
| SMILES | CCC(O)CC1OCCCO1 |
| InChI | InChI=1S/C8H16O3/c1-2-7(9)6-8-10-4-3-5-11-8/h7-9H,2-6H2,1H3 |
| InChIKey | SPXPFJDDEDOLOX-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |