C12H22O4 — CID 101487132
(3R,4S)-7-(1,3-dioxan-2-yl)-6-methylhept-1-ene-3,4-diol (PubChem CID 101487132) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is (3R,4S)-7-(1,3-dioxan-2-yl)-6-methylhept-1-ene-3,4-diol.
| Compound Name | (3R,4S)-7-(1,3-dioxan-2-yl)-6-methylhept-1-ene-3,4-diol |
|---|---|
| PubChem CID | 101487132 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | (3R,4S)-7-(1,3-dioxan-2-yl)-6-methylhept-1-ene-3,4-diol |
| SMILES | C=C[C@@H](O)[C@@H](O)CC(C)CC1OCCCO1 |
| InChI | InChI=1S/C12H22O4/c1-3-10(13)11(14)7-9(2)8-12-15-5-4-6-16-12/h3,9-14H,1,4-8H2,2H3/t9?,10-,11+/m1/s1 |
| InChIKey | MVHITNKKOOKEKW-ZOCYIJKUSA-N |
| XLogP | 1.07 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|