C15H32ClNO2 — CID 142532435
3-chloroazetidine;2-(2-methylbutyl)-1,3-dioxane;propane (PubChem CID 142532435) has the molecular formula C15H32ClNO2 and a molecular weight of 293.88 g/mol. Its IUPAC name is 3-chloroazetidine;2-(2-methylbutyl)-1,3-dioxane;propane.
| Compound Name | 3-chloroazetidine;2-(2-methylbutyl)-1,3-dioxane;propane |
|---|---|
| PubChem CID | 142532435 |
| Molecular Formula | C15H32ClNO2 |
| Molecular Weight | 293.88 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 3-chloroazetidine;2-(2-methylbutyl)-1,3-dioxane;propane |
| SMILES | CCC.CCC(C)CC1OCCCO1.ClC1CNC1 |
| InChI | InChI=1S/C9H18O2.C3H6ClN.C3H8/c1-3-8(2)7-9-10-5-4-6-11-9;4-3-1-5-2-3;1-3-2/h8-9H,3-7H2,1-2H3;3,5H,1-2H2;3H2,1-2H3 |
| InChIKey | RKEAUZTXGFDGBG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.88 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|