C7H15NO2 — CID 82111184
1-(1,3-dioxan-2-yl)propan-2-amine (PubChem CID 82111184) has the molecular formula C7H15NO2 and a molecular weight of 145.20 g/mol. Its IUPAC name is 1-(1,3-dioxan-2-yl)propan-2-amine.
| Compound Name | 1-(1,3-dioxan-2-yl)propan-2-amine |
|---|---|
| PubChem CID | 82111184 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | 1-(1,3-dioxan-2-yl)propan-2-amine |
| SMILES | CC(N)CC1OCCCO1 |
| InChI | InChI=1S/C7H15NO2/c1-6(8)5-7-9-3-2-4-10-7/h6-7H,2-5,8H2,1H3 |
| InChIKey | DSFVDMZKUDDICF-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |