C9H17NO2 — CID 103544185
1-cyclobutyl-2-(1,3-dioxolan-2-yl)ethanamine (PubChem CID 103544185) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is 1-cyclobutyl-2-(1,3-dioxolan-2-yl)ethanamine.
| Compound Name | 1-cyclobutyl-2-(1,3-dioxolan-2-yl)ethanamine |
|---|---|
| PubChem CID | 103544185 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 1-cyclobutyl-2-(1,3-dioxolan-2-yl)ethanamine |
| SMILES | NC(CC1OCCO1)C1CCC1 |
| InChI | InChI=1S/C9H17NO2/c10-8(7-2-1-3-7)6-9-11-4-5-12-9/h7-9H,1-6,10H2 |
| InChIKey | AEXIRQFLMAMYEB-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |