C17H36BrO2P — CID 18705686
tributyl(1,3-dioxan-2-ylmethyl)phosphanium bromide (PubChem CID 18705686) has the molecular formula C17H36BrO2P and a molecular weight of 383.35 g/mol. Its IUPAC name is tributyl(1,3-dioxan-2-ylmethyl)phosphanium bromide.
| Compound Name | tributyl(1,3-dioxan-2-ylmethyl)phosphanium bromide |
|---|---|
| PubChem CID | 18705686 |
| Molecular Formula | C17H36BrO2P |
| Molecular Weight | 383.35 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | tributyl(1,3-dioxan-2-ylmethyl)phosphanium bromide |
| SMILES | CCCC[P+](CCCC)(CCCC)CC1OCCCO1.[Br-] |
| InChI | InChI=1S/C17H36O2P.BrH/c1-4-7-13-20(14-8-5-2,15-9-6-3)16-17-18-11-10-12-19-17;/h17H,4-16H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | JBKMIQBGAFQGNO-UHFFFAOYSA-M |
| XLogP | 2.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|