About 2-[2-(1,3-dioxolan-2-yl)ethyl]-1,3-dioxane
2-[2-(1,3-dioxolan-2-yl)ethyl]-1,3-dioxane (PubChem CID 91071611) has the molecular formula C9H16O4
and a molecular weight of 188.22 g/mol. Its IUPAC name is 2-[2-(1,3-dioxolan-2-yl)ethyl]-1,3-dioxane.
Molecular Properties
| Compound Name | 2-[2-(1,3-dioxolan-2-yl)ethyl]-1,3-dioxane |
| PubChem CID | 91071611 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 2-[2-(1,3-dioxolan-2-yl)ethyl]-1,3-dioxane |
| SMILES | C1COC(CCC2OCCO2)OC1 |
| InChI | InChI=1S/C9H16O4/c1-4-10-8(11-5-1)2-3-9-12-6-7-13-9/h8-9H,1-7H2 |
| InChIKey | CBOYZTGICYGPPK-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(1,3-dioxolan-2-yl)ethyl]-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1,3-dioxolan-2-yl)ethyl]-1,3-dioxane?
The IUPAC name of 2-[2-(1,3-dioxolan-2-yl)ethyl]-1,3-dioxane (CID 91071611) is 2-[2-(1,3-dioxolan-2-yl)ethyl]-1,3-dioxane.
What is the SMILES notation for 2-[2-(1,3-dioxolan-2-yl)ethyl]-1,3-dioxane?
The canonical SMILES for 2-[2-(1,3-dioxolan-2-yl)ethyl]-1,3-dioxane is C1COC(CCC2OCCO2)OC1.
What is the InChIKey of 2-[2-(1,3-dioxolan-2-yl)ethyl]-1,3-dioxane?
The InChIKey is CBOYZTGICYGPPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4/c1-4-10-8(11-5-1)2-3-9-12-6-7-13-9/h8-9H,1-7H2.
What are the key properties of 2-[2-(1,3-dioxolan-2-yl)ethyl]-1,3-dioxane?
2-[2-(1,3-dioxolan-2-yl)ethyl]-1,3-dioxane has a molecular weight of 188.22 g/mol, XLogP of 0.90, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1,3-dioxolan-2-yl)ethyl]-1,3-dioxane is sourced from PubChem (CID 91071611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).