C9H16O4 — CID 91071611
2-[2-(1,3-dioxolan-2-yl)ethyl]-1,3-dioxane (PubChem CID 91071611) has the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. Its IUPAC name is 2-[2-(1,3-dioxolan-2-yl)ethyl]-1,3-dioxane.
| Compound Name | 2-[2-(1,3-dioxolan-2-yl)ethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 91071611 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 2-[2-(1,3-dioxolan-2-yl)ethyl]-1,3-dioxane |
| SMILES | C1COC(CCC2OCCO2)OC1 |
| InChI | InChI=1S/C9H16O4/c1-4-10-8(11-5-1)2-3-9-12-6-7-13-9/h8-9H,1-7H2 |
| InChIKey | CBOYZTGICYGPPK-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |