C11H21NO2 — CID 10655617
(2R)-2-[2-(1,3-dioxan-2-yl)ethyl]piperidine (PubChem CID 10655617) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is (2R)-2-[2-(1,3-dioxan-2-yl)ethyl]piperidine.
| Compound Name | (2R)-2-[2-(1,3-dioxan-2-yl)ethyl]piperidine |
|---|---|
| PubChem CID | 10655617 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | (2R)-2-[2-(1,3-dioxan-2-yl)ethyl]piperidine |
| SMILES | C1CC[C@H](CCC2OCCCO2)NC1 |
| InChI | InChI=1S/C11H21NO2/c1-2-7-12-10(4-1)5-6-11-13-8-3-9-14-11/h10-12H,1-9H2/t10-/m1/s1 |
| InChIKey | BXXYVTXFHBLNDO-SNVBAGLBSA-N |
| XLogP | 1.67 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |