About 2-(piperidin-2-ylmethyl)-1,3-oxazinane;hydrochloride
2-(piperidin-2-ylmethyl)-1,3-oxazinane;hydrochloride (PubChem CID 117225973) has the molecular formula C10H21ClN2O
and a molecular weight of 220.74 g/mol. Its IUPAC name is 2-(piperidin-2-ylmethyl)-1,3-oxazinane;hydrochloride.
Molecular Properties
| Compound Name | 2-(piperidin-2-ylmethyl)-1,3-oxazinane;hydrochloride |
| PubChem CID | 117225973 |
| Molecular Formula | C10H21ClN2O |
| Molecular Weight | 220.74 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 2-(piperidin-2-ylmethyl)-1,3-oxazinane;hydrochloride |
| SMILES | C1CCC(CC2NCCCO2)NC1.Cl |
| InChI | InChI=1S/C10H20N2O.ClH/c1-2-5-11-9(4-1)8-10-12-6-3-7-13-10;/h9-12H,1-8H2;1H |
| InChIKey | WEINKAGFALJOLP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.74 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(piperidin-2-ylmethyl)-1,3-oxazinane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(piperidin-2-ylmethyl)-1,3-oxazinane;hydrochloride?
The IUPAC name of 2-(piperidin-2-ylmethyl)-1,3-oxazinane;hydrochloride (CID 117225973) is 2-(piperidin-2-ylmethyl)-1,3-oxazinane;hydrochloride.
What is the SMILES notation for 2-(piperidin-2-ylmethyl)-1,3-oxazinane;hydrochloride?
The canonical SMILES for 2-(piperidin-2-ylmethyl)-1,3-oxazinane;hydrochloride is C1CCC(CC2NCCCO2)NC1.Cl.
What is the InChIKey of 2-(piperidin-2-ylmethyl)-1,3-oxazinane;hydrochloride?
The InChIKey is WEINKAGFALJOLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O.ClH/c1-2-5-11-9(4-1)8-10-12-6-3-7-13-10;/h9-12H,1-8H2;1H.
What are the key properties of 2-(piperidin-2-ylmethyl)-1,3-oxazinane;hydrochloride?
2-(piperidin-2-ylmethyl)-1,3-oxazinane;hydrochloride has a molecular weight of 220.74 g/mol, XLogP of 1.28, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(piperidin-2-ylmethyl)-1,3-oxazinane;hydrochloride is sourced from PubChem (CID 117225973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).