About 2-(thiolan-2-ylmethyl)-1,3-oxazinane
2-(thiolan-2-ylmethyl)-1,3-oxazinane (PubChem CID 117225958) has the molecular formula C9H17NOS
and a molecular weight of 187.31 g/mol. Its IUPAC name is 2-(thiolan-2-ylmethyl)-1,3-oxazinane.
Molecular Properties
| Compound Name | 2-(thiolan-2-ylmethyl)-1,3-oxazinane |
| PubChem CID | 117225958 |
| Molecular Formula | C9H17NOS |
| Molecular Weight | 187.31 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 2-(thiolan-2-ylmethyl)-1,3-oxazinane |
| SMILES | C1CNC(CC2CCCS2)OC1 |
| InChI | InChI=1S/C9H17NOS/c1-3-8(12-6-1)7-9-10-4-2-5-11-9/h8-10H,1-7H2 |
| InChIKey | BUWQZGIWXIGLME-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(thiolan-2-ylmethyl)-1,3-oxazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(thiolan-2-ylmethyl)-1,3-oxazinane?
The IUPAC name of 2-(thiolan-2-ylmethyl)-1,3-oxazinane (CID 117225958) is 2-(thiolan-2-ylmethyl)-1,3-oxazinane.
What is the SMILES notation for 2-(thiolan-2-ylmethyl)-1,3-oxazinane?
The canonical SMILES for 2-(thiolan-2-ylmethyl)-1,3-oxazinane is C1CNC(CC2CCCS2)OC1.
What is the InChIKey of 2-(thiolan-2-ylmethyl)-1,3-oxazinane?
The InChIKey is BUWQZGIWXIGLME-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NOS/c1-3-8(12-6-1)7-9-10-4-2-5-11-9/h8-10H,1-7H2.
What are the key properties of 2-(thiolan-2-ylmethyl)-1,3-oxazinane?
2-(thiolan-2-ylmethyl)-1,3-oxazinane has a molecular weight of 187.31 g/mol, XLogP of 1.61, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(thiolan-2-ylmethyl)-1,3-oxazinane is sourced from PubChem (CID 117225958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).