About 5,5-dimethyl-2-(thian-2-ylmethyl)-1,3-oxazinane
5,5-dimethyl-2-(thian-2-ylmethyl)-1,3-oxazinane (PubChem CID 117226611) has the molecular formula C12H23NOS
and a molecular weight of 229.39 g/mol. Its IUPAC name is 5,5-dimethyl-2-(thian-2-ylmethyl)-1,3-oxazinane.
Molecular Properties
| Compound Name | 5,5-dimethyl-2-(thian-2-ylmethyl)-1,3-oxazinane |
| PubChem CID | 117226611 |
| Molecular Formula | C12H23NOS |
| Molecular Weight | 229.39 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 5,5-dimethyl-2-(thian-2-ylmethyl)-1,3-oxazinane |
| SMILES | CC1(C)CNC(CC2CCCCS2)OC1 |
| InChI | InChI=1S/C12H23NOS/c1-12(2)8-13-11(14-9-12)7-10-5-3-4-6-15-10/h10-11,13H,3-9H2,1-2H3 |
| InChIKey | VLRQTSJEQOUNHD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,5-dimethyl-2-(thian-2-ylmethyl)-1,3-oxazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-2-(thian-2-ylmethyl)-1,3-oxazinane?
The IUPAC name of 5,5-dimethyl-2-(thian-2-ylmethyl)-1,3-oxazinane (CID 117226611) is 5,5-dimethyl-2-(thian-2-ylmethyl)-1,3-oxazinane.
What is the SMILES notation for 5,5-dimethyl-2-(thian-2-ylmethyl)-1,3-oxazinane?
The canonical SMILES for 5,5-dimethyl-2-(thian-2-ylmethyl)-1,3-oxazinane is CC1(C)CNC(CC2CCCCS2)OC1.
What is the InChIKey of 5,5-dimethyl-2-(thian-2-ylmethyl)-1,3-oxazinane?
The InChIKey is VLRQTSJEQOUNHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NOS/c1-12(2)8-13-11(14-9-12)7-10-5-3-4-6-15-10/h10-11,13H,3-9H2,1-2H3.
What are the key properties of 5,5-dimethyl-2-(thian-2-ylmethyl)-1,3-oxazinane?
5,5-dimethyl-2-(thian-2-ylmethyl)-1,3-oxazinane has a molecular weight of 229.39 g/mol, XLogP of 2.63, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-2-(thian-2-ylmethyl)-1,3-oxazinane is sourced from PubChem (CID 117226611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).