C11H21NO2 — CID 117226259
5,5-dimethyl-2-(oxolan-3-ylmethyl)-1,3-oxazinane (PubChem CID 117226259) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is 5,5-dimethyl-2-(oxolan-3-ylmethyl)-1,3-oxazinane.
| Compound Name | 5,5-dimethyl-2-(oxolan-3-ylmethyl)-1,3-oxazinane |
|---|---|
| PubChem CID | 117226259 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 5,5-dimethyl-2-(oxolan-3-ylmethyl)-1,3-oxazinane |
| SMILES | CC1(C)CNC(CC2CCOC2)OC1 |
| InChI | InChI=1S/C11H21NO2/c1-11(2)7-12-10(14-8-11)5-9-3-4-13-6-9/h9-10,12H,3-8H2,1-2H3 |
| InChIKey | RHJDMXGRNMHIEG-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |