About 2-(oxan-4-ylmethyl)-1,3-oxazolidine
2-(oxan-4-ylmethyl)-1,3-oxazolidine (PubChem CID 117225640) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is 2-(oxan-4-ylmethyl)-1,3-oxazolidine.
Molecular Properties
| Compound Name | 2-(oxan-4-ylmethyl)-1,3-oxazolidine |
| PubChem CID | 117225640 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 2-(oxan-4-ylmethyl)-1,3-oxazolidine |
| SMILES | C1COC(CC2CCOCC2)N1 |
| InChI | InChI=1S/C9H17NO2/c1-4-11-5-2-8(1)7-9-10-3-6-12-9/h8-10H,1-7H2 |
| InChIKey | BZAQWLKYUJZOHU-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(oxan-4-ylmethyl)-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxan-4-ylmethyl)-1,3-oxazolidine?
The IUPAC name of 2-(oxan-4-ylmethyl)-1,3-oxazolidine (CID 117225640) is 2-(oxan-4-ylmethyl)-1,3-oxazolidine.
What is the SMILES notation for 2-(oxan-4-ylmethyl)-1,3-oxazolidine?
The canonical SMILES for 2-(oxan-4-ylmethyl)-1,3-oxazolidine is C1COC(CC2CCOCC2)N1.
What is the InChIKey of 2-(oxan-4-ylmethyl)-1,3-oxazolidine?
The InChIKey is BZAQWLKYUJZOHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2/c1-4-11-5-2-8(1)7-9-10-3-6-12-9/h8-10H,1-7H2.
What are the key properties of 2-(oxan-4-ylmethyl)-1,3-oxazolidine?
2-(oxan-4-ylmethyl)-1,3-oxazolidine has a molecular weight of 171.24 g/mol, XLogP of 0.75, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxan-4-ylmethyl)-1,3-oxazolidine is sourced from PubChem (CID 117225640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).