C9H17NO2 — CID 117225640
2-(oxan-4-ylmethyl)-1,3-oxazolidine (PubChem CID 117225640) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is 2-(oxan-4-ylmethyl)-1,3-oxazolidine.
| Compound Name | 2-(oxan-4-ylmethyl)-1,3-oxazolidine |
|---|---|
| PubChem CID | 117225640 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 2-(oxan-4-ylmethyl)-1,3-oxazolidine |
| SMILES | C1COC(CC2CCOCC2)N1 |
| InChI | InChI=1S/C9H17NO2/c1-4-11-5-2-8(1)7-9-10-3-6-12-9/h8-10H,1-7H2 |
| InChIKey | BZAQWLKYUJZOHU-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |