C11H22N2O — CID 117225733
2-[(1-ethylpiperidin-3-yl)methyl]-1,3-oxazolidine (PubChem CID 117225733) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is 2-[(1-ethylpiperidin-3-yl)methyl]-1,3-oxazolidine.
| Compound Name | 2-[(1-ethylpiperidin-3-yl)methyl]-1,3-oxazolidine |
|---|---|
| PubChem CID | 117225733 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 2-[(1-ethylpiperidin-3-yl)methyl]-1,3-oxazolidine |
| SMILES | CCN1CCCC(CC2NCCO2)C1 |
| InChI | InChI=1S/C11H22N2O/c1-2-13-6-3-4-10(9-13)8-11-12-5-7-14-11/h10-12H,2-9H2,1H3 |
| InChIKey | RFOMNVJKVUEQEV-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |