About 2-(1-ethylpiperidin-3-yl)-1,3-oxazolidine
2-(1-ethylpiperidin-3-yl)-1,3-oxazolidine (PubChem CID 117225664) has the molecular formula C10H20N2O
and a molecular weight of 184.28 g/mol. Its IUPAC name is 2-(1-ethylpiperidin-3-yl)-1,3-oxazolidine.
Molecular Properties
| Compound Name | 2-(1-ethylpiperidin-3-yl)-1,3-oxazolidine |
| PubChem CID | 117225664 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 2-(1-ethylpiperidin-3-yl)-1,3-oxazolidine |
| SMILES | CCN1CCCC(C2NCCO2)C1 |
| InChI | InChI=1S/C10H20N2O/c1-2-12-6-3-4-9(8-12)10-11-5-7-13-10/h9-11H,2-8H2,1H3 |
| InChIKey | UQXPOPNQIBFTNM-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1-ethylpiperidin-3-yl)-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-ethylpiperidin-3-yl)-1,3-oxazolidine?
The IUPAC name of 2-(1-ethylpiperidin-3-yl)-1,3-oxazolidine (CID 117225664) is 2-(1-ethylpiperidin-3-yl)-1,3-oxazolidine.
What is the SMILES notation for 2-(1-ethylpiperidin-3-yl)-1,3-oxazolidine?
The canonical SMILES for 2-(1-ethylpiperidin-3-yl)-1,3-oxazolidine is CCN1CCCC(C2NCCO2)C1.
What is the InChIKey of 2-(1-ethylpiperidin-3-yl)-1,3-oxazolidine?
The InChIKey is UQXPOPNQIBFTNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O/c1-2-12-6-3-4-9(8-12)10-11-5-7-13-10/h9-11H,2-8H2,1H3.
What are the key properties of 2-(1-ethylpiperidin-3-yl)-1,3-oxazolidine?
2-(1-ethylpiperidin-3-yl)-1,3-oxazolidine has a molecular weight of 184.28 g/mol, XLogP of 0.66, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-ethylpiperidin-3-yl)-1,3-oxazolidine is sourced from PubChem (CID 117225664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).