C13H27N3 — CID 64942661
1-(1-ethylpiperidin-3-yl)-3-methyl-1,4-diazepane (PubChem CID 64942661) has the molecular formula C13H27N3 and a molecular weight of 225.38 g/mol. Its IUPAC name is 1-(1-ethylpiperidin-3-yl)-3-methyl-1,4-diazepane.
| Compound Name | 1-(1-ethylpiperidin-3-yl)-3-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 64942661 |
| Molecular Formula | C13H27N3 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.22 |
| IUPAC Name | 1-(1-ethylpiperidin-3-yl)-3-methyl-1,4-diazepane |
| SMILES | CCN1CCCC(N2CCCNC(C)C2)C1 |
| InChI | InChI=1S/C13H27N3/c1-3-15-8-4-6-13(11-15)16-9-5-7-14-12(2)10-16/h12-14H,3-11H2,1-2H3 |
| InChIKey | WRWHKMFLUOVUOQ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |