C10H21BN2 — CID 174064097
1-(1-ethylpiperidin-3-yl)-3-methyl-1,3-azaboretidine (PubChem CID 174064097) has the molecular formula C10H21BN2 and a molecular weight of 180.10 g/mol. Its IUPAC name is 1-(1-ethylpiperidin-3-yl)-3-methyl-1,3-azaboretidine.
| Compound Name | 1-(1-ethylpiperidin-3-yl)-3-methyl-1,3-azaboretidine |
|---|---|
| PubChem CID | 174064097 |
| Molecular Formula | C10H21BN2 |
| Molecular Weight | 180.10 g/mol |
| Exact Mass | 180.18 |
| IUPAC Name | 1-(1-ethylpiperidin-3-yl)-3-methyl-1,3-azaboretidine |
| SMILES | CCN1CCCC(N2CB(C)C2)C1 |
| InChI | InChI=1S/C10H21BN2/c1-3-12-6-4-5-10(7-12)13-8-11(2)9-13/h10H,3-9H2,1-2H3 |
| InChIKey | RVAJNBAPUILTDC-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.10 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|